FLIAABGS0006
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=3-(4-Methoxyphenyl)-5-hydroxy-7-[6-O-(1-oxo-2-carboxyethyl)-beta-D-glucopyranosyloxy]-4H-1-benzopyran-4-one |
|Common Name=&&Bichanin A 7-O-glucoside-6"-malonate&& | |Common Name=&&Bichanin A 7-O-glucoside-6"-malonate&& | ||
|CAS=34232-17-2 | |CAS=34232-17-2 | ||
|KNApSAcK=C00010117 | |KNApSAcK=C00010117 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 34232-17-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIAABGS0006.mol |
Bichanin A 7-O-glucoside-6"-malonate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C25H24O13 |
Exact Mass | 532.121690854 |
Average Mass | 532.45026 |
SMILES | O=C(CC(O)=O)OCC([C@H](O)4)O[C@H]([C@H]([C@H]4O)O)O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|