FLIAAANP0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3-(4-Hydroxyphenyl)-5-hydroxy-8,8-dimethyl-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one | |SysName=3-(4-Hydroxyphenyl)-5-hydroxy-8,8-dimethyl-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one | ||
| − | |Common Name=&&Derrone&& | + | |Common Name=&&Derrone&&3-(4-Hydroxyphenyl)-5-hydroxy-8,8-dimethyl-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one&& |
|CAS=76166-59-1 | |CAS=76166-59-1 | ||
|KNApSAcK=C00009493 | |KNApSAcK=C00009493 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 76166-59-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAAANP0003.mol |
| Derrone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-(4-Hydroxyphenyl)-5-hydroxy-8,8-dimethyl-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H16O5 |
| Exact Mass | 336.099773622 |
| Average Mass | 336.33804000000003 |
| SMILES | c(c14)(OC=C(C4=O)c(c3)ccc(O)c3)c(C=2)c(OC(C2)(C)C) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
