FLIA2CNS0003
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 2746-85-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA2CNS0003.mol |
| Fujikinetin methyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6,7-Dimethoxy-3',4'-methylenedioxyisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H14O6 |
| Exact Mass | 326.07903818 |
| Average Mass | 326.30016 |
| SMILES | c(c(OC)4)(OC)cc(c1c4)OC=C(c(c3)cc(c2c3)OCO2)C1=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
