FL7AAIGL0016
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3,5,7,4'-Tetrahydroxy-3',5'-dimethoxyflavylium 3-(6"-acetylglucoside)-5-glucoside | |SysName=3,5,7,4'-Tetrahydroxy-3',5'-dimethoxyflavylium 3-(6"-acetylglucoside)-5-glucoside | ||
| − | |Common Name=&&Malvidin 3-(6"-acetylglucoside)-5-glucoside && | + | |Common Name=&&Malvidin 3-(6"-acetylglucoside)-5-glucoside&&3,5,7,4'-Tetrahydroxy-3',5'-dimethoxyflavylium 3-(6"-acetylglucoside)-5-glucoside&& |
|CAS=164266-06-2 | |CAS=164266-06-2 | ||
|KNApSAcK=C00006907 | |KNApSAcK=C00006907 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 164266-06-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL7AAIGL0016.mol |
| Malvidin 3-(6"-acetylglucoside)-5-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,4'-Tetrahydroxy-3',5'-dimethoxyflavylium 3-(6"-acetylglucoside)-5-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C31H37O18 |
| Exact Mass | 697.1979893800001 |
| Average Mass | 697.61468 |
| SMILES | O([C@@H](C(O)5)O[C@@H]([C@@H](C5O)O)COC(C)=O)c(c3) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
