FL7AACGO0003
From Metabolomics.JP
(Difference between revisions)
m (FL7AACGS0003 moved to FL7AACGO0003) |
Revision as of 14:40, 7 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 38533-30-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL7AACGO0003.mol |
| Cyanidin 3-rhamnoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-(6-Deoxy-alpha-L-mannopyranosyloxy)-5,7-dihydroxy-2-(3,4-dihydroxyphenyl)-1-benzopyrylium |
| Common Name |
|
| Symbol | |
| Formula | C21H21O10 |
| Exact Mass | 433.113471892 |
| Average Mass | 433.38544 |
| SMILES | c(c(O)4)c(O)c(c(c4)2)cc(c(c(c3)cc(c(O)c3)O)[o+1]2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
