FL7AACGL0058
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=??3,5,7,3',4'-Pentahydroxyflavylium 3-glucoside-3'-(6"-caffeylglucoside) |
|Common Name=&&Cyanidin 3-glucoside-3'-(6"-caffeylglucoside)&& | |Common Name=&&Cyanidin 3-glucoside-3'-(6"-caffeylglucoside)&& | ||
|CAS=150070-20-5 | |CAS=150070-20-5 | ||
|KNApSAcK=C00006829 | |KNApSAcK=C00006829 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 150070-20-5 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL7AACGL0058.mol |
Cyanidin 3-glucoside-3'-(6"-caffeylglucoside) | |
---|---|
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C36H37O19 |
Exact Mass | 773.192904002 |
Average Mass | 773.66758 |
SMILES | OC(C6O)C(OC(C(O)6)COC(C=Cc(c5)ccc(c5O)O)=O)Oc(c1)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|