FL7AACGL0041
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | - |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL7AACGL0041.mol |
Cyanidin 3-(6"-malonyl-2"-glucuronosylglucoside) | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3,5,7,3',4'-Pentahydroxyflavylium 3-(6"-malonyl-2"-glucuronosylglucoside) |
Common Name |
|
Symbol | |
Formula | C30H31O20 |
Exact Mass | 711.1408684319999 |
Average Mass | 711.55514 |
SMILES | O(C1Oc(c3)c(c(c5)cc(O)c(c5)O)[o+1]c(c4)c3c(cc4O)O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|