FL6FABNS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
{{Metabolite  | {{Metabolite  | ||
| − | |  | + | |Sysname=5,7-Dihydroxy-4'-methoxyflavan  | 
|Common Name=&&5,7-Dihydroxy-4'-methoxyflavan&&  | |Common Name=&&5,7-Dihydroxy-4'-methoxyflavan&&  | ||
|CAS=131866-08-5  | |CAS=131866-08-5  | ||
|KNApSAcK=C00008754  | |KNApSAcK=C00008754  | ||
}}  | }}  | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 131866-08-5 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL6FABNS0001.mol | 
| 5,7-Dihydroxy-4'-methoxyflavan | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | |
| Common Name | 
  | 
| Symbol | |
| Formula | C16H16O4 | 
| Exact Mass | 272.104859 | 
| Average Mass | 272.29584 | 
| SMILES | COc(c3)ccc(c3)C(C2)Oc(c1)c(C2)c(O)cc(O)1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
