FL6FAAGS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
{{Metabolite  | {{Metabolite  | ||
|SysName=5,7,4'-Trihydroxyflavan 5-O-xyloside  | |SysName=5,7,4'-Trihydroxyflavan 5-O-xyloside  | ||
| − | |Common Name=&&Apigeniflavan 5-O-xyloside&&  | + | |Common Name=&&Apigeniflavan 5-O-xyloside&&5,7,4'-Trihydroxyflavan 5-O-xyloside&&  | 
|CAS=61402-86-6  | |CAS=61402-86-6  | ||
|KNApSAcK=C00008771  | |KNApSAcK=C00008771  | ||
}}  | }}  | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 61402-86-6 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL6FAAGS0001.mol | 
| Apigeniflavan 5-O-xyloside | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxyflavan 5-O-xyloside | 
| Common Name | 
  | 
| Symbol | |
| Formula | C20H22O8 | 
| Exact Mass | 390.13146768 | 
| Average Mass | 390.38388000000003 | 
| SMILES |  C(O1)(Oc(c4)c(c(cc(O)4)3)CCC(O3)c(c2)ccc(O)c2)C(O) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
