FL6DPTNS0006
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | - |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL6DPTNS0006.mol |
4-O-Methyl-3',4'-methylenedioxymopanan-4alpha-ol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 4-O-Methyl-3',4'-methylenedioxymopanan-4alpha-ol |
Common Name |
|
Symbol | |
Formula | C18H16O6 |
Exact Mass | 328.094688244 |
Average Mass | 328.31604 |
SMILES | O(c45)C(C(C(c4ccc(O)c5)OC)3)c(c2CO3)ccc(c21)OCO1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|