FL6DAANS0001
From Metabolomics.JP
(Difference between revisions)
m |
|||
| (2 intermediate revisions by one user not shown) | |||
| Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3,4,5,7 | + | |SysName=3,4-Dihydro-2-(4-hydroxyphenyl)-2H-1-benzopyran-3,4,5,7-tetrol |
| − | |Common Name=&&Leucopelargonidin&&Afzelechin-4beta-ol&& | + | |Common Name=&&Leucopelargonidin&&Afzelechin-4beta-ol&&3,4,5,7,4'-Pentahydroxyflavan&&Goratensidin&&Leucopelargonidine&&Leucopelargonidol&& |
|CAS=520-17-2; 98919-66-5 | |CAS=520-17-2; 98919-66-5 | ||
|KNApSAcK=C00020638 | |KNApSAcK=C00020638 | ||
}} | }} | ||
Latest revision as of 10:49, 8 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL6D Flavan 3,4-diol : FL6DAA Leucopelargonidin (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 520-17-2; 98919-66-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6DAANS0001.mol |
| Leucopelargonidin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4-Dihydro-2-(4-hydroxyphenyl)-2H-1-benzopyran-3,4,5,7-tetrol |
| Common Name |
|
| Symbol | |
| Formula | C15H14O6 |
| Exact Mass | 290.07903818 |
| Average Mass | 290.26806 |
| SMILES | Oc(c3)ccc(c3)C(O1)C(O)C(O)c(c(O)2)c(cc(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
