FL6D1CNS0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=(2S,3R,4S)-3,4,7,3',4'-Pentahydroxyflavan | |SysName=(2S,3R,4S)-3,4,7,3',4'-Pentahydroxyflavan | ||
| − | |Common Name=&&ent-Fisetinidol-4beta-ol&& | + | |Common Name=&&ent-Fisetinidol-4beta-ol&&(2S,3R,4S)-3,4,7,3',4'-Pentahydroxyflavan&& |
|CAS=- | |CAS=- | ||
|KNApSAcK=C00008998 | |KNApSAcK=C00008998 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | - |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6D1CNS0004.mol |
| ent-Fisetinidol-4beta-ol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S,3R,4S)-3,4,7,3',4'-Pentahydroxyflavan |
| Common Name |
|
| Symbol | |
| Formula | C15H14O6 |
| Exact Mass | 290.07903818 |
| Average Mass | 290.26806 |
| SMILES | Oc(c3)cc(O1)c(c3)C(O)C(O)C1c(c2)cc(O)c(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
