FL63PTNM0001
From Metabolomics.JP
(Difference between revisions)
| (6 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(+)-8-Hydroxy-5,5-dimethylpeltogynan | + | |SysName= (+) -8-Hydroxy-5,5-dimethylpeltogynan |
| − | |Common Name=&&(+)-8-Hydroxy-5,5-dimethylpeltogynan&& | + | |Common Name=&& (+) -8-Hydroxy-5,5-dimethylpeltogynan&& |
|CAS=132125-04-3 | |CAS=132125-04-3 | ||
|KNApSAcK=C00009042 | |KNApSAcK=C00009042 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL63 Flavan 3-ol : FL63PT Peltogynoid flavan (2 pages) : FL63PTNM C-Methyl or C2/C3 substituted (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 132125-04-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63PTNM0001.mol |
| (+) -8-Hydroxy-5,5-dimethylpeltogynan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (+) -8-Hydroxy-5,5-dimethylpeltogynan |
| Common Name |
|
| Symbol | |
| Formula | C18H18O6 |
| Exact Mass | 330.110338308 |
| Average Mass | 330.33191999999997 |
| SMILES | C(c34)C(O2)C(Oc3cc(O)cc4O)c(c(C2(C)C)1)cc(O)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
