FL63A9NS0002
From Metabolomics.JP
(Difference between revisions)
| (2 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2R,3R)-3,5,7,3',5'-Pentahydroxyflavan | + | |SysName= (2R,3R) -3,5,7,3',5'-Pentahydroxyflavan |
| − | |Common Name=&&(2R,3R)-3,5,7,3',5'-Pentahydroxyflavan&& | + | |Common Name=&& (2R,3R) -3,5,7,3',5'-Pentahydroxyflavan&& |
|CAS=87592-94-7 | |CAS=87592-94-7 | ||
|KNApSAcK=C00008828 | |KNApSAcK=C00008828 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL63 Flavan 3-ol : FL63A9 3,5,7,(3'),(5')-Hydroxyflavan (1 pages) : FL63A9NS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 87592-94-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63A9NS0002.mol |
| (2R,3R) -3,5,7,3',5'-Pentahydroxyflavan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3R) -3,5,7,3',5'-Pentahydroxyflavan |
| Common Name |
|
| Symbol | |
| Formula | C15H14O6 |
| Exact Mass | 290.07903818 |
| Average Mass | 290.26806 |
| SMILES | Oc(c3)cc(cc(O)3)C(O1)C(O)Cc(c(O)2)c(cc(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| [show] Species-Flavonoid Relationship Reported |
|---|
