FL5FFANS0019
From Metabolomics.JP
(Difference between revisions)
| (6 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=3,4',5,8-Tetrahydroxy-7-methoxyflavone 8-acetate |
| − | |Common Name=&&Pollenitin 8-acetate&& | + | |Common Name=&&Pollenitin 8-acetate&&3,4',5,8-Tetrahydroxy-7-methoxyflavone 8-acetate&& |
|CAS=69306-84-9 | |CAS=69306-84-9 | ||
|KNApSAcK=C00004924 | |KNApSAcK=C00004924 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FFA Herbacetin and O-methyl derivatives (70 pages) : FL5FFANS Simple substitution (24 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 69306-84-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FFANS0019.mol |
| Pollenitin 8-acetate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4',5,8-Tetrahydroxy-7-methoxyflavone 8-acetate |
| Common Name |
|
| Symbol | |
| Formula | C18H14O8 |
| Exact Mass | 358.068867424 |
| Average Mass | 358.29896 |
| SMILES | c(C(O2)=C(C(c(c(O)3)c2c(c(OC)c3)OC(C)=O)=O)O)(c1)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
