FL5FF9NS0006
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |SysName=5,7-Dihydroxy-3,8-dimethoxy-2-phenyl-4H-1-benzopyran-4-one |
|Common Name=&&Gnaphaliin&&5,7-Dihydroxy-3,8-dimethoxyflavone&&3-O-Methyl-8-methoxygalangin&&5,7-Dihydroxy-3,8-dimethoxy-2-phenyl-4H-1-benzopyran-4-one&& | |Common Name=&&Gnaphaliin&&5,7-Dihydroxy-3,8-dimethoxyflavone&&3-O-Methyl-8-methoxygalangin&&5,7-Dihydroxy-3,8-dimethoxy-2-phenyl-4H-1-benzopyran-4-one&& | ||
|CAS=33803-42-8 | |CAS=33803-42-8 | ||
|KNApSAcK=C00004556 | |KNApSAcK=C00004556 | ||
}} | }} |
Revision as of 09:00, 13 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 33803-42-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FF9NS0006.mol |
Gnaphaliin | |
---|---|
Structural Information | |
Systematic Name | 5,7-Dihydroxy-3,8-dimethoxy-2-phenyl-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C17H14O6 |
Exact Mass | 314.07903818 |
Average Mass | 314.28945999999996 |
SMILES | COc(c(O)3)c(O1)c(c(O)c3)C(=O)C(OC)=C(c(c2)cccc2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |