FL5FECNS0017
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one | + | |SysName=2- (3,4-dihydroxyphenyl) -5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name= | + | |Common Name=&&5,3',4'-Trihydroxy-3,6,7-trimethoxyflavone&&Chrysosplenol D&&Quercetagetin 3,6,7-Trimethyl ether&&2- (3,4-dihydroxyphenyl) -5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one&& |
|CAS=14965-20-9 | |CAS=14965-20-9 | ||
|KNApSAcK=C00004692 | |KNApSAcK=C00004692 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FEC Quercetagetin and O-methyl derivatives (150 pages) : FL5FECNS Simple substitution (54 pages) : FL5FECNS0 Normal (44 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 14965-20-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FECNS0017.mol |
| 5,3',4'-Trihydroxy-3,6,7-trimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,4-dihydroxyphenyl) -5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O8 |
| Exact Mass | 360.08451748799996 |
| Average Mass | 360.31484 |
| SMILES | c(c3OC)c(O1)c(c(c3OC)O)C(C(=C1c(c2)cc(O)c(O)c2)OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
