FL5FECNS0017
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
|Common Name=&&Chrysosplenol D&&5,3',4'-Trihydroxy-3,6,7-trimethoxyflavone&&Quercetagetin 3,6,7-Trimethyl ether&&2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one&& | |Common Name=&&Chrysosplenol D&&5,3',4'-Trihydroxy-3,6,7-trimethoxyflavone&&Quercetagetin 3,6,7-Trimethyl ether&&2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one&& | ||
|CAS=14965-20-9 | |CAS=14965-20-9 | ||
|KNApSAcK=C00004692 | |KNApSAcK=C00004692 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 14965-20-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FECNS0017.mol |
| Chrysosplenol D | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O8 |
| Exact Mass | 360.08451748799996 |
| Average Mass | 360.31484 |
| SMILES | c(c3OC)c(O1)c(c(c3OC)O)C(C(=C1c(c2)cc(O)c(O)c2)OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
