FL5FEANS0014
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=6,4'-Dihydroxy-3,5,7-trimeoxyflavone |
| − | |Common Name=&&6-Hydroxykaempferol 3,5,7-trimethyl ether&& | + | |Common Name=&&6-Hydroxykaempferol 3,5,7-trimethyl ether&&6,4'-Dihydroxy-3,5,7-trimeoxyflavone&& |
|CAS=154662-03-0 | |CAS=154662-03-0 | ||
|KNApSAcK=C00004602 | |KNApSAcK=C00004602 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FEA 6-Hydroxykaempferol and O-methyl derivatives (74 pages) : FL5FEANS Simple substitution (25 pages) : FL5FEANS0 Normal (20 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 154662-03-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FEANS0014.mol |
| 6-Hydroxykaempferol 3,5,7-trimethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6,4'-Dihydroxy-3,5,7-trimeoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H16O7 |
| Exact Mass | 344.089602866 |
| Average Mass | 344.31543999999997 |
| SMILES | c(c3OC)c(O1)c(c(c3O)OC)C(C(=C1c(c2)ccc(O)c2)OC)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
