FL5FE9NM0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| (One intermediate revision by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}}  | ||
| + | |||
{{Metabolite  | {{Metabolite  | ||
|SysName=3,5,6,7-Tetrahydroxy-8-methylflavone  | |SysName=3,5,6,7-Tetrahydroxy-8-methylflavone  | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FE9 5,6,7,(3'),(5')-Hydroxyflavonol and O-methyl derivatives (12 pages) : FL5FE9NM C-Methyl or C2/C3 substituted (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 114567-38-3 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FE9NM0001.mol | 
| Isoplatanin | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 3,5,6,7-Tetrahydroxy-8-methylflavone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C16H12O6 | 
| Exact Mass | 300.063388116 | 
| Average Mass | 300.26288 | 
| SMILES | c(c3)ccc(c3)C(O1)=C(O)C(=O)c(c(O)2)c1c(C)c(O)c(O)2 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
