FL5FDBNS0001
From Metabolomics.JP
(Difference between revisions)
| (One intermediate revision by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7-Dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one | + | |SysName=5,7-Dihydroxy-3-methoxy-2- (4-methoxyphenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&5,7-Dihydroxy-3,4'-dimethoxyflavone&&Ermanin&&Kaempferol 3,4'-di-O-methyl ether&&5,7-Dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&5,7-Dihydroxy-3,4'-dimethoxyflavone&&Ermanin&&Kaempferol 3,4'-di-O-methyl ether&&5,7-Dihydroxy-3-methoxy-2- (4-methoxyphenyl) -4H-1-benzopyran-4-one&& |
|CAS=20869-95-8 | |CAS=20869-95-8 | ||
|KNApSAcK=C00004570 | |KNApSAcK=C00004570 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FDB Kaempferol O-methyl derivatives (4'-methoxy, without FL5FAB, FL5FBB, FL5FCB) (7 pages) : FL5FDBNS Simple substitution (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 20869-95-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDBNS0001.mol |
| 5,7-Dihydroxy-3,4'-dimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-3-methoxy-2- (4-methoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O6 |
| Exact Mass | 314.07903818 |
| Average Mass | 314.28945999999996 |
| SMILES | COc(c3)ccc(c3)C(O1)=C(OC)C(=O)c(c(O)2)c(cc(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
