FL5FCJGA0001
From Metabolomics.JP
(Difference between revisions)
| (6 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=3,5,3',5'-Tetrahydroxy-7,4'-dimethoxyflavone 3-galactoside |
| − | |Common Name=&&Myricetin 7,4'-dimethyl ether 3-galactoside&& | + | |Common Name=&&Myricetin 7,4'-dimethyl ether 3-galactoside&&3,5,3',5'-Tetrahydroxy-7,4'-dimethoxyflavone 3-galactoside&& |
|CAS=86828-99-1 | |CAS=86828-99-1 | ||
|KNApSAcK=C00005774 | |KNApSAcK=C00005774 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FCJ Myricetin 7,4'-dimethyl ether (1 pages) : FL5FCJGA 3-Galactoside and related (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 86828-99-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FCJGA0001.mol |
| Myricetin 7,4'-dimethyl ether 3-galactoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,3',5'-Tetrahydroxy-7,4'-dimethoxyflavone 3-galactoside |
| Common Name |
|
| Symbol | |
| Formula | C23H24O13 |
| Exact Mass | 508.121690854 |
| Average Mass | 508.42886 |
| SMILES | O([C@H](O4)C(O)C([C@H]([C@@H](CO)4)O)O)C(C(=O)2)=C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
