FL5FADNI0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| (One intermediate revision by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
| {{Metabolite | {{Metabolite | ||
| − | |SysName=3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | + | |SysName=3,5,7-Trihydroxy-2- (4-hydroxy-3-methoxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one | 
| − | |Common Name=&&Gancaonin P 3'methyl ether&&3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&Gancaonin P 3'methyl ether&&3,5,7-Trihydroxy-2- (4-hydroxy-3-methoxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one&& | 
| |CAS=151776-21-5 | |CAS=151776-21-5 | ||
| |KNApSAcK=C00005013 | |KNApSAcK=C00005013 | ||
| }} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAD Isorhamnetin (110 pages) : FL5FADNI Non-cyclic prenyl substituted (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 151776-21-5 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FADNI0001.mol | 
| Gancaonin P 3'methyl ether | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | 3,5,7-Trihydroxy-2- (4-hydroxy-3-methoxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one | 
| Common Name | 
 | 
| Symbol | |
| Formula | C21H20O7 | 
| Exact Mass | 384.120902994 | 
| Average Mass | 384.37929999999994 | 
| SMILES | C(c(c3O)c(O)cc(c31)OC(c(c2)cc(c(O)c2)OC)=C(C1=O)O) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
| 
 | 
