FL5FACNSS004
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=3,5,7,3',4'-Pentahydroxyflavone 3,7-di-O-sulfate |
|Common Name=&&Quercetin 3,7-di-O-sulfate&& | |Common Name=&&Quercetin 3,7-di-O-sulfate&& | ||
|CAS=106533-85-1 | |CAS=106533-85-1 | ||
|KNApSAcK=C00004959 | |KNApSAcK=C00004959 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 106533-85-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FACNSS004.mol |
Quercetin 3,7-di-O-sulfate | |
---|---|
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C15H10O13S2 |
Exact Mass | 461.956281786 |
Average Mass | 462.3641 |
SMILES | Oc(c3)c(O)cc(c3)C(O1)=C(OS(O)(=O)=O)C(=O)c(c(O)2)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|