FL5FACNC0001
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=8-p- | + | |SysName=3,5,7,3',4'-Pentahydroxy-8- (p-hydroxybenzyl) flavone |
| − | |Common Name=&&8-p-Hydroxybenzylquercetin&& | + | |Common Name=&&8-p-Hydroxybenzylquercetin&&3,5,7,3',4'-Pentahydroxy-8- (p-hydroxybenzyl) flavone&& |
|CAS=163399-32-4 | |CAS=163399-32-4 | ||
|KNApSAcK=C00005039 | |KNApSAcK=C00005039 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAC Quercetin (289 pages) : FL5FACNC Flavonoid substituted by complex substituent (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 163399-32-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FACNC0001.mol |
| 8-p-Hydroxybenzylquercetin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,3',4'-Pentahydroxy-8- (p-hydroxybenzyl) flavone |
| Common Name |
|
| Symbol | |
| Formula | C22H16O8 |
| Exact Mass | 408.08451748799996 |
| Average Mass | 408.35764000000006 |
| SMILES | C(C=3O)(=O)c(c(O)2)c(OC3c(c4)ccc(c4O)O)c(c(c2)O)Cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
