FL5FACGL0001
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3,5,7,3',4'-Pentahydroxyflavone 3-beta-D-glucoside |
| − | |Common Name=&&Isoquercitrin&&Hirsutrin&&Quercetin 3-beta-D-glucoside&& && | + | |Common Name=&&Isoquercitrin&&Hirsutrin&&Quercetin 3-glucoside&&Quercetin 3-beta-D-glucoside&&3-Glucosylquercetin&&Hirsutrin&&Isoquercetin&& |
|CAS=482-35-9 | |CAS=482-35-9 | ||
|KNApSAcK=C00005373 | |KNApSAcK=C00005373 | ||
}} | }} | ||
Latest revision as of 16:24, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAC Quercetin (289 pages) : FL5FACGL 3-Glucoside and related (79 pages) : FL5FACGL0 Normal (78 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 482-35-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FACGL0001.mol |
| Isoquercitrin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,3',4'-Pentahydroxyflavone 3-beta-D-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C21H20O12 |
| Exact Mass | 464.095476104 |
| Average Mass | 464.37629999999996 |
| SMILES | O(C(C(=O)3)=C(Oc(c4)c3c(cc(O)4)O)c(c2)cc(c(O)c2)O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
