FL5FAANI0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | + | |SysName=3,5,7-Trihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
− | |Common Name=&&Licoflavonol&&3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&Licoflavonol&&3,5,7-Trihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one&& |
|CAS=60197-60-6 | |CAS=60197-60-6 | ||
|KNApSAcK=C00004993 | |KNApSAcK=C00004993 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 60197-60-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FAANI0001.mol |
Licoflavonol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3,5,7-Trihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C20H18O6 |
Exact Mass | 354.110338308 |
Average Mass | 354.35332 |
SMILES | c(c3)c(ccc(O)3)C(=C2O)Oc(c1C2=O)cc(c(CC=C(C)C)c1O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|