FL5FA9GL0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3,5,7-Trihydroxyflavone 3-rhamnosyl-(1->6)-glucoside |
|Common Name=&&Galanginoside&& | |Common Name=&&Galanginoside&& | ||
|CAS=16268-50-1 | |CAS=16268-50-1 | ||
|KNApSAcK=C00005123 | |KNApSAcK=C00005123 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 16268-50-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FA9GL0002.mol |
| Galanginoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7-Trihydroxyflavone 3-rhamnosyl-(1->6)-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C27H30O14 |
| Exact Mass | 578.163555668 |
| Average Mass | 578.5187000000001 |
| SMILES | C(C2O)(OC(C(=O)4)=C(c(c5)cccc5)Oc(c43)cc(O)cc3O)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
