FL5F19NF0001
From Metabolomics.JP
(Difference between revisions)
| (7 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=3-Methoxy-2-phenyl-4H-Furo [ 2,3-h ] -1-benzopyran-4-one |
| − | |Common Name=&&Karanjin&&3-Methoxy-2-phenyl-4H-Furo[2,3-h]-1-benzopyran-4-one&& | + | |Common Name=&&Karanjin&&3-Methoxy-2-phenyl-4H-Furo [ 2,3-h ] -1-benzopyran-4-one&& |
|CAS=521-88-0 | |CAS=521-88-0 | ||
|KNApSAcK=C00005089 | |KNApSAcK=C00005089 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5F19 7,(3'),(5')-Hydroxyflavonol and O-methyl derivatives (4 pages) : FL5F19NF Furanoflavonoid (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 521-88-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5F19NF0001.mol |
| Karanjin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-Methoxy-2-phenyl-4H-Furo [ 2,3-h ] -1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H12O4 |
| Exact Mass | 292.073558872 |
| Average Mass | 292.28548 |
| SMILES | c(C(O4)=C(C(c(c43)ccc(c32)occ2)=O)OC)(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
