FL4DDANS0001
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 1 February 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 97231-20-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL4DDANS0001.mol |
Aromadendrin 3-methyl ether | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Aromadendrin 3-methyl ether |
Common Name |
|
Symbol | |
Formula | C16H14O6 |
Exact Mass | 302.07903818 |
Average Mass | 302.27876000000003 |
SMILES | CO[C@@H](C(=O)2)[C@H](Oc(c3)c(c(O)cc(O)3)2)c(c1)cc |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|