FL4DCENS0001
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2R,3R)-3,5,3'-Trihydroxy-7,4'-dimethoxyflavanone | + | |SysName= (2R,3R) -3,5,3'-Trihydroxy-7,4'-dimethoxyflavanone |
| − | |Common Name= | + | |Common Name=&& (2R,3R) -3,5,3'-Trihydroxy-7,4'-dimethoxyflavanone&&Taxifolin 7,4'-dimethyl ether&& |
|CAS=79995-67-8 | |CAS=79995-67-8 | ||
|KNApSAcK=C00008582 | |KNApSAcK=C00008582 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL4 Dihydroflavonol : FL4DCE Taxifolin 7,4'-dimethyl ether (3 pages) : FL4DCENS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 79995-67-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DCENS0001.mol |
| (2R,3R) -3,5,3'-Trihydroxy-7,4'-dimethoxyflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3R) -3,5,3'-Trihydroxy-7,4'-dimethoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C17H16O7 |
| Exact Mass | 332.089602866 |
| Average Mass | 332.30474 |
| SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)[C@H](O)[C@H]1c(c2)cc(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
