FL4DAGNS0002
From Metabolomics.JP
(Difference between revisions)
| (7 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName= (2R,3S) -3,5,7,3',4',5'-Hexahydroxyflavanone |
| − | |Common Name=&&Hovenitin III&&(2R,3S)-3,5,7,3',4',5'-Hexahydroxyflavanone&& | + | |Common Name=&&Hovenitin III&& (2R,3S) -3,5,7,3',4',5'-Hexahydroxyflavanone&& |
|CAS=119439-94-0 | |CAS=119439-94-0 | ||
|KNApSAcK=C00014369 | |KNApSAcK=C00014369 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL4 Dihydroflavonol : FL4DAG Dihydromyricetin (Ampelopsin) (8 pages) : FL4DAGNS Simple substitution (2 pages) : FL4DAGNS0 Normal (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 119439-94-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DAGNS0002.mol |
| Hovenitin III | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3S) -3,5,7,3',4',5'-Hexahydroxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C15H12O8 |
| Exact Mass | 320.05321735999996 |
| Average Mass | 320.25098 |
| SMILES | Oc(c3)cc(O1)c(c(O)3)C(=O)C(O)C1c(c2)cc(O)c(O)c(O)2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
