FL4DADNP0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3,5,4'-Trihydroxy-3'-methoxy-6",6"-dimethylpyrano[2",3":7,6]flavanone | + | |SysName=3,5,4'-Trihydroxy-3'-methoxy-6",6"-dimethylpyrano [ 2",3":7,6 ] flavanone |
| − | |Common Name=&&Eriotrinol&&3,5,4'-Trihydroxy-3'-methoxy-6",6"-dimethylpyrano[2",3":7,6]flavanone&& | + | |Common Name=&&Eriotrinol&&3,5,4'-Trihydroxy-3'-methoxy-6",6"-dimethylpyrano [ 2",3":7,6 ] flavanone&& |
|CAS=151590-49-7 | |CAS=151590-49-7 | ||
|KNApSAcK=C00008639 | |KNApSAcK=C00008639 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 151590-49-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DADNP0001.mol |
| Eriotrinol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,4'-Trihydroxy-3'-methoxy-6",6"-dimethylpyrano [ 2",3":7,6 ] flavanone |
| Common Name |
|
| Symbol | |
| Formula | C21H20O7 |
| Exact Mass | 384.120902994 |
| Average Mass | 384.37929999999994 |
| SMILES | O([C@H](c(c4)cc(c(O)c4)OC)3)c(c(C([C@H](O)3)=O)2)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
