FL4DACNM0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=3,5,7,3',4'-Pentahydroxy-8-methylflavanone |
|Common Name=&&Deodarin&& | |Common Name=&&Deodarin&& | ||
|CAS=33788-39-5 | |CAS=33788-39-5 | ||
|KNApSAcK=C00008595 | |KNApSAcK=C00008595 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 33788-39-5 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL4DACNM0002.mol |
Deodarin | |
---|---|
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C16H14O7 |
Exact Mass | 318.073952802 |
Average Mass | 318.27816 |
SMILES | Oc(c3)c(O)cc(c3)C(O1)C(O)C(=O)c(c(O)2)c1c(C)c(O)c2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|