FL4DACGS0012
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(2R,3S)-3,5,7,3',4'-Pentahydroxyflavanone 3-rhamnoside | + | |SysName= (2R,3S) -3,5,7,3',4'-Pentahydroxyflavanone 3-rhamnoside |
− | |Common Name=&&Isoastibin&&(2R,3S)-3,5,7,3',4'-Pentahydroxyflavanone 3-rhamnoside&& | + | |Common Name=&&Isoastibin&& (2R,3S) -3,5,7,3',4'-Pentahydroxyflavanone 3-rhamnoside&& |
|CAS=54081-48-0 | |CAS=54081-48-0 | ||
|KNApSAcK=C00008704 | |KNApSAcK=C00008704 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 54081-48-0 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL4DACGS0012.mol |
Isoastibin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (2R,3S) -3,5,7,3',4'-Pentahydroxyflavanone 3-rhamnoside |
Common Name |
|
Symbol | |
Formula | C21H22O11 |
Exact Mass | 450.116211546 |
Average Mass | 450.39278 |
SMILES | C(C(=O)3)(C(Oc(c4)c3c(cc(O)4)O)c(c2)cc(c(O)c2)O)OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|