FL4DACGS0009
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2S,3S)-3',4',5,7-Tetrahydroxy-3-(beta-D-glucopyranosyloxy)flavanone | + | |SysName= (2S,3S) -3',4',5,7-Tetrahydroxy-3- (beta-D-glucopyranosyloxy) flavanone |
| − | |Common Name=&&(2S,3S)-Taxifolin 3-glucoside&& | + | |Common Name=&& (2S,3S) -Taxifolin 3-glucoside&& (2S,3S) -3',4',5,7-Tetrahydroxy-3- (beta-D-glucopyranosyloxy) flavanone&& |
|CAS=129212-92-6 | |CAS=129212-92-6 | ||
|KNApSAcK=C00008701 | |KNApSAcK=C00008701 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL4 Dihydroflavonol : FL4DAC Dihydroquercetin (Taxifolin) (49 pages) : FL4DACGS O-Glycoside (30 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 129212-92-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DACGS0009.mol |
| (2S,3S) -Taxifolin 3-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S,3S) -3',4',5,7-Tetrahydroxy-3- (beta-D-glucopyranosyloxy) flavanone |
| Common Name |
|
| Symbol | |
| Formula | C21H22O12 |
| Exact Mass | 466.111126168 |
| Average Mass | 466.39218 |
| SMILES | O(C(C(=O)3)C(Oc(c4)c3c(cc(O)4)O)c(c2)cc(c(O)c2)O)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
