FL4DAANI0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2R)-2,3-Dihydro-3beta,5,7-trihydroxy-2alpha-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | + | |SysName= (2R) -2,3-Dihydro-3beta,5,7-trihydroxy-2alpha- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Shuterin&&(2R)-2,3-Dihydro-3beta,5,7-trihydroxy-2alpha-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&Shuterin&& (2R) -2,3-Dihydro-3beta,5,7-trihydroxy-2alpha- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one&& |
|CAS=105377-77-3 | |CAS=105377-77-3 | ||
|KNApSAcK=C00008613 | |KNApSAcK=C00008613 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 105377-77-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DAANI0001.mol |
| Shuterin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R) -2,3-Dihydro-3beta,5,7-trihydroxy-2alpha- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H20O6 |
| Exact Mass | 356.125988372 |
| Average Mass | 356.3692 |
| SMILES | c(c3)c(ccc(O)3)C(C2O)Oc(c1C2=O)cc(c(CC=C(C)C)c1O)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
