FL4DA9NS0011
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2R,3S)-3-Hydroxy-5,7-dimethoxyflavanone | + | |SysName= (2R,3S) -3-Hydroxy-5,7-dimethoxyflavanone |
| − | |Common Name=&&cis-3-Hydroxy-5,7-dimethoxyflavanone&&(2R,3S)-3-Hydroxy-5,7-dimethoxyflavanone&& | + | |Common Name=&&cis-3-Hydroxy-5,7-dimethoxyflavanone&& (2R,3S) -3-Hydroxy-5,7-dimethoxyflavanone&& |
|CAS=693253-07-5 | |CAS=693253-07-5 | ||
|KNApSAcK=C00014363 | |KNApSAcK=C00014363 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 693253-07-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DA9NS0011.mol |
| cis-3-Hydroxy-5,7-dimethoxyflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3S) -3-Hydroxy-5,7-dimethoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C17H16O5 |
| Exact Mass | 300.099773622 |
| Average Mass | 300.30593999999996 |
| SMILES | COc(c3)cc(O1)c(c(OC)3)C(=O)C([H])(O)C([H])1c(c2)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
