FL4DA8NP0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(3R)-3-Methoxyminimiflorin | + | |SysName=(3R)-3-Methoxyminimiflorin |
|Common Name=&&(3R)-3-Methoxyminimiflorin&&5,2'-Dihydroxy-3-methoxy-8-prenyl-6",6"-dimethylpyrano[2",3":7,6]flavanone&& | |Common Name=&&(3R)-3-Methoxyminimiflorin&&5,2'-Dihydroxy-3-methoxy-8-prenyl-6",6"-dimethylpyrano[2",3":7,6]flavanone&& | ||
|CAS=259812-80-1 | |CAS=259812-80-1 | ||
|KNApSAcK=C00014396 | |KNApSAcK=C00014396 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 259812-80-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL4DA8NP0002.mol |
(3R)-3-Methoxyminimiflorin | |
---|---|
Structural Information | |
Systematic Name | (3R)-3-Methoxyminimiflorin |
Common Name |
|
Symbol | |
Formula | C26H28O6 |
Exact Mass | 436.188588628 |
Average Mass | 436.49692 |
SMILES | O(C(C)(C)4)c(c(CC=C(C)C)1)c(C=C4)c(O)c(C(=O)2)c1OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|