FL3FQUNP0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Artonol D | + | |SysName=Artonol D |
|Common Name=&&Artonol D&&6-Hydroxy-3,3,12,12-tetramethyl-9-(1-methylethenyl)-3H,7H,8H-[1]benzopyrano[7,6-c]pyrano[3,2-h]xanthene-7,10,15(9H,12H)-trione&& | |Common Name=&&Artonol D&&6-Hydroxy-3,3,12,12-tetramethyl-9-(1-methylethenyl)-3H,7H,8H-[1]benzopyrano[7,6-c]pyrano[3,2-h]xanthene-7,10,15(9H,12H)-trione&& | ||
|CAS=186824-60-2 | |CAS=186824-60-2 | ||
|KNApSAcK=C00013494 | |KNApSAcK=C00013494 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 186824-60-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FQUNP0002.mol |
| Artonol D | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Artonol D |
| Common Name |
|
| Symbol | |
| Formula | C30H26O7 |
| Exact Mass | 498.167853186 |
| Average Mass | 498.52324 |
| SMILES | c(c6=O)(C(C(C)=C)4)c(c(=O)c(c65)C=CC(O5)(C)C)C(O1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
