FL3FGCNS0003
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=5,7,3',4'-Tetrahydroxy-6,8-dimethoxyflavone | |SysName=5,7,3',4'-Tetrahydroxy-6,8-dimethoxyflavone | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FGC 5,6,7,8,3',4'-Hexahydroxyflavone and O-methyl derivatives (31 pages) : FL3FGCNS Simple substitution (18 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 57093-50-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FGCNS0003.mol |
| 5,7,3',4'-Tetrahydroxy-6,8-dimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,3',4'-Tetrahydroxy-6,8-dimethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C17H14O8 |
| Exact Mass | 346.068867424 |
| Average Mass | 346.28826 |
| SMILES | COc(c(O)1)c(O)c(C(=O)3)c(OC(=C3)c(c2)cc(O)c(O)c2)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
