FL3FGCGS0012
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 1 February 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 404891-11-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FGCGS0012.mol |
Zeravschanoside | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Zeravschanoside&&5,6,7,8,3',4'-Hexsahydroxy 7-glucoside&&2-(3,4-Dihydroxyphenyl)-7-(beta-D-glucopyranosyloxy)-5,6,8-trihydroxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C21H20O13 |
Exact Mass | 480.090390726 |
Average Mass | 480.37569999999994 |
SMILES | C(C1Oc(c4O)c(c(c3c4O)OC(=CC3=O)c(c2)cc(c(O)c2)O)O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|