FL3FG8NS0008
From Metabolomics.JP
(Difference between revisions)
| (7 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=2- (3,6-Dihydroxy-2-methoxyphenyl) -5,7-dihydroxy-6,8-dimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&5,7,3',6'-Tetrahydroxy-6,8,2'-trimethoxyflavone&&2-(3,6-Dihydroxy-2-methoxyphenyl)-5,7-dihydroxy-6,8-dimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&5,7,3',6'-Tetrahydroxy-6,8,2'-trimethoxyflavone&&2- (3,6-Dihydroxy-2-methoxyphenyl) -5,7-dihydroxy-6,8-dimethoxy-4H-1-benzopyran-4-one&& |
|CAS=160389-07-1 | |CAS=160389-07-1 | ||
|KNApSAcK=C00013346 | |KNApSAcK=C00013346 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FG8 5,6,7,8,2',(3'),(5'),(6')-Hydroxyflavone O-methyl derivatives (8 pages) : FL3FG8NS Simple substitution (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 160389-07-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FG8NS0008.mol |
| 5,7,3',6'-Tetrahydroxy-6,8,2'-trimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,6-Dihydroxy-2-methoxyphenyl) -5,7-dihydroxy-6,8-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O9 |
| Exact Mass | 376.07943210999997 |
| Average Mass | 376.31424 |
| SMILES | C(C2=O)=C(Oc(c3OC)c2c(c(c3O)OC)O)c(c(O)1)c(OC)c(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
