FL3FFLNS0003
From Metabolomics.JP
(Difference between revisions)
| (One intermediate revision by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5-Hydroxy-7,8-dimethoxy-2-(2,3,4-trimethoxyphenyl)-4H-1-benzopyran-4-one | + | |SysName=5-Hydroxy-7,8-dimethoxy-2- (2,3,4-trimethoxyphenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&5-Hydroxy-2',3',4',7,8-pentamethoxyflavone&&Serpyllin&&5-Hydroxy-7,8-dimethoxy-2-(2,3,4-trimethoxyphenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&5-Hydroxy-2',3',4',7,8-pentamethoxyflavone&&Serpyllin&&5-Hydroxy-7,8-dimethoxy-2- (2,3,4-trimethoxyphenyl) -4H-1-benzopyran-4-one&& |
|CAS=21315-67-3 | |CAS=21315-67-3 | ||
|KNApSAcK=C00003953 | |KNApSAcK=C00003953 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FFL 5,7,8,2',(3'),4',(5'),(6')-Hydroxyflavone O-methyl derivatives (4 pages) : FL3FFLNS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 21315-67-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FFLNS0003.mol |
| 5-Hydroxy-2',3',4',7,8-pentamethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-7,8-dimethoxy-2- (2,3,4-trimethoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H20O8 |
| Exact Mass | 388.11581761599996 |
| Average Mass | 388.368 |
| SMILES | COc(c3OC)cc(O)c(c23)C(=O)C=C(O2)c(c1OC)ccc(c1OC)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
