FL3FFCNS0006
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=2-(3,4-Dimethoxyphenyl)-5-hydroxy-7,8-dimethoxy-4H-1-benzopyran-4-one | |SysName=2-(3,4-Dimethoxyphenyl)-5-hydroxy-7,8-dimethoxy-4H-1-benzopyran-4-one | ||
| − | |Common Name=&& | + | |Common Name=&&5-Hydroxy-7,8,3',4'-tetramethoxyflavone&&Hypolaetin 7,8,3',4'-tetramethyl ether&&2-(3,4-Dimethoxyphenyl)-5-hydroxy-7,8-dimethoxy-4H-1-benzopyran-4-one&& |
|CAS=13003-74-2 | |CAS=13003-74-2 | ||
|KNApSAcK=C00003911 | |KNApSAcK=C00003911 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 13003-74-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FFCNS0006.mol |
| 5-Hydroxy-7,8,3',4'-tetramethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-(3,4-Dimethoxyphenyl)-5-hydroxy-7,8-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H18O7 |
| Exact Mass | 358.10525293 |
| Average Mass | 358.34202000000005 |
| SMILES | O(C(c(c3)cc(OC)c(OC)c3)=1)c(c2OC)c(c(O)cc2OC)C(=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
