FL3FEGNS0008
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7-Dihydroxy-6-methoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one | + | |SysName=5,7-Dihydroxy-6-methoxy-2- (3,4,5-trimethoxyphenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Arteanoflavone&&5,7-Dihydroxy-6-methoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&Arteanoflavone&&5,7-Dihydroxy-6-methoxy-2- (3,4,5-trimethoxyphenyl) -4H-1-benzopyran-4-one&& |
|CAS=68710-17-8 | |CAS=68710-17-8 | ||
|KNApSAcK=C00003948 | |KNApSAcK=C00003948 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 68710-17-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FEGNS0008.mol |
| Arteanoflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-6-methoxy-2- (3,4,5-trimethoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H18O8 |
| Exact Mass | 374.100167552 |
| Average Mass | 374.34142 |
| SMILES | c(c1OC)(O)cc(O2)c(C(=O)C=C2c(c3)cc(c(c(OC)3)OC)OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
