FL3FECNS0004
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one | + | |SysName=2- (3,4-Dihydroxyphenyl) -5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Nepetin&& | + | |Common Name=&&Nepetin&&2- (3,4-Dihydroxyphenyl) -5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one&& |
|CAS=520-11-6 | |CAS=520-11-6 | ||
|KNApSAcK=C00003885 | |KNApSAcK=C00003885 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FEC 6-Hydroxyluteolin and O-methyl derivatives (85 pages) : FL3FECNS Simple substitution (32 pages) : FL3FECNS0 Normal (23 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 520-11-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FECNS0004.mol |
| Nepetin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,4-Dihydroxyphenyl) -5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C16H12O7 |
| Exact Mass | 316.058302738 |
| Average Mass | 316.26228000000003 |
| SMILES | COc(c(O)3)c(O)c(C(=O)2)c(c3)OC(=C2)c(c1)cc(O)c(O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
