FL3FECGS0029
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 1 February 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 25474-11-7 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FECGS0029.mol |
6-Hydroxyluteolin 6,3'-dimethyl ether 7-glucoside | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 6-Hydroxyluteolin 6,3'-dimethyl ether 7-glucoside |
Common Name |
|
Symbol | |
Formula | C23H24O12 |
Exact Mass | 492.126776232 |
Average Mass | 492.42946 |
SMILES | COc(c3O[C@@H]([C@@H](O)4)OC(CO)[C@@H]([C@@H]4O)O)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|