FL3FEANS0011
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5-Allyloxy-6,7,4'-trimethoxyflavone |
| − | |Common Name=&&5-Allyloxysalvigenin&& | + | |Common Name=&&5-Allyloxysalvigenin&&5-Allyloxy-6,7,4'-trimethoxyflavone&& |
|CAS=87200-85-9 | |CAS=87200-85-9 | ||
|KNApSAcK=C00004022 | |KNApSAcK=C00004022 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FEA Scutellarein and O-methyl derivatives (71 pages) : FL3FEANS Simple substitution (14 pages) : FL3FEANS0 Normal (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 87200-85-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FEANS0011.mol |
| 5-Allyloxysalvigenin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Allyloxy-6,7,4'-trimethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C21H20O6 |
| Exact Mass | 368.125988372 |
| Average Mass | 368.37989999999996 |
| SMILES | COc(c3OC)cc(c2c(OCC=C)3)OC(=CC2=O)c(c1)ccc(OC)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
