FL3FEANS0001
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one | + | |SysName=5,7-Dihydroxy-2- (4-hydroxyphenyl) -6-methoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Hispidulin&& | + | |Common Name=&&Hispidulin&&6-Methoxyapigenin&&6-Methylscutellarein&& |
|CAS=1447-88-7 | |CAS=1447-88-7 | ||
|KNApSAcK=C00001050 | |KNApSAcK=C00001050 | ||
}} | }} | ||
Latest revision as of 13:51, 6 August 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FEA Scutellarein and O-methyl derivatives (71 pages) : FL3FEANS Simple substitution (14 pages) : FL3FEANS0 Normal (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1447-88-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FEANS0001.mol |
| Hispidulin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-2- (4-hydroxyphenyl) -6-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C16H12O6 |
| Exact Mass | 300.063388116 |
| Average Mass | 300.26288 |
| SMILES | COc(c(O)3)c(O)c(C(=O)2)c(c3)OC(=C2)c(c1)ccc(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
